C16H19F6NO2P+ — CID 91437570
[1-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2-(methylamino)-3-oxopropan-2-yl]-methyl-methylidenephosphanium (PubChem CID 91437570) has the molecular formula C16H19F6NO2P+ and a molecular weight of 402.30 g/mol. Its IUPAC name is [1-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2-(methylamino)-3-oxopropan-2-yl]-methyl-methylidenephosphanium.
| Compound Name | [1-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2-(methylamino)-3-oxopropan-2-yl]-methyl-methylidenephosphanium |
|---|---|
| PubChem CID | 91437570 |
| Molecular Formula | C16H19F6NO2P+ |
| Molecular Weight | 402.30 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | [1-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2-(methylamino)-3-oxopropan-2-yl]-methyl-methylidenephosphanium |
| SMILES | C=[P+](C)C(C=O)(COC(C)c1cc(C(F)(F)F)cc(C(F)(F)F)c1)NC |
| InChI | InChI=1S/C16H19F6NO2P/c1-10(25-9-14(8-24,23-2)26(3)4)11-5-12(15(17,18)19)7-13(6-11)16(20,21)22/h5-8,10,23H,3,9H2,1-2,4H3/q+1 |
| InChIKey | KZFIOORCIITORS-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.30 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|