C20H15BF7NO4 — CID 58718519
CID 58718519 (PubChem CID 58718519) has the molecular formula C20H15BF7NO4 and a molecular weight of 477.14 g/mol.
| Compound Name | CID 58718519 |
|---|---|
| PubChem CID | 58718519 |
| Molecular Formula | C20H15BF7NO4 |
| Molecular Weight | 477.14 g/mol |
| Exact Mass | 477.10 |
| IUPAC Name | — |
| SMILES | [B]C(=O)N[C@@](CO[C@H](C)c1cc(C(F)(F)F)cc(C(F)(F)F)c1)(C(=O)O)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H15BF7NO4/c1-10(11-6-13(19(23,24)25)8-14(7-11)20(26,27)28)33-9-18(16(30)31,29-17(21)32)12-2-4-15(22)5-3-12/h2-8,10H,9H2,1H3,(H,29,32)(H,30,31)/t10-,18-/m1/s1 |
| InChIKey | SHRCMLIVTVJNKR-MLCYQJTMSA-N |
| XLogP | 4.80 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.14 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|