C21H19F7O4 — CID 20722771
1-[1-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2-(4-fluorophenyl)-2-hydroxyethoxy]propan-2-one (PubChem CID 20722771) has the molecular formula C21H19F7O4 and a molecular weight of 468.37 g/mol. Its IUPAC name is 1-[1-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2-(4-fluorophenyl)-2-hydroxyethoxy]propan-2-one.
| Compound Name | 1-[1-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2-(4-fluorophenyl)-2-hydroxyethoxy]propan-2-one |
|---|---|
| PubChem CID | 20722771 |
| Molecular Formula | C21H19F7O4 |
| Molecular Weight | 468.37 g/mol |
| Exact Mass | 468.12 |
| IUPAC Name | 1-[1-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2-(4-fluorophenyl)-2-hydroxyethoxy]propan-2-one |
| SMILES | CC(=O)COC(OC(C)c1cc(C(F)(F)F)cc(C(F)(F)F)c1)C(O)c1ccc(F)cc1 |
| InChI | InChI=1S/C21H19F7O4/c1-11(29)10-31-19(18(30)13-3-5-17(22)6-4-13)32-12(2)14-7-15(20(23,24)25)9-16(8-14)21(26,27)28/h3-9,12,18-19,30H,10H2,1-2H3 |
| InChIKey | QTFCFFFBEHZSRQ-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.37 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|