C20H19F7O4 — CID 86759428
2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-1-(4-fluorophenyl)-2-(2-hydroxyethoxy)ethanol (PubChem CID 86759428) has the molecular formula C20H19F7O4 and a molecular weight of 456.35 g/mol. Its IUPAC name is 2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-1-(4-fluorophenyl)-2-(2-hydroxyethoxy)ethanol.
| Compound Name | 2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-1-(4-fluorophenyl)-2-(2-hydroxyethoxy)ethanol |
|---|---|
| PubChem CID | 86759428 |
| Molecular Formula | C20H19F7O4 |
| Molecular Weight | 456.35 g/mol |
| Exact Mass | 456.12 |
| IUPAC Name | 2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-1-(4-fluorophenyl)-2-(2-hydroxyethoxy)ethanol |
| SMILES | C[C@@H](OC(OCCO)C(O)c1ccc(F)cc1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H19F7O4/c1-11(13-8-14(19(22,23)24)10-15(9-13)20(25,26)27)31-18(30-7-6-28)17(29)12-2-4-16(21)5-3-12/h2-5,8-11,17-18,28-29H,6-7H2,1H3/t11-,17?,18?/m1/s1 |
| InChIKey | IOMKPJZQNFWMSO-IPPDQLOFSA-N |
| XLogP | 5.01 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.35 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|