C23H22F7NO3 — CID 59083021
(5S)-6-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-5-(4-fluorophenyl)-5-(methylamino)hexane-2,4-dione (PubChem CID 59083021) has the molecular formula C23H22F7NO3 and a molecular weight of 493.42 g/mol. Its IUPAC name is (5S)-6-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-5-(4-fluorophenyl)-5-(methylamino)hexane-2,4-dione.
| Compound Name | (5S)-6-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-5-(4-fluorophenyl)-5-(methylamino)hexane-2,4-dione |
|---|---|
| PubChem CID | 59083021 |
| Molecular Formula | C23H22F7NO3 |
| Molecular Weight | 493.42 g/mol |
| Exact Mass | 493.15 |
| IUPAC Name | (5S)-6-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-5-(4-fluorophenyl)-5-(methylamino)hexane-2,4-dione |
| SMILES | CN[C@@](CO[C@H](C)c1cc(C(F)(F)F)cc(C(F)(F)F)c1)(C(=O)CC(C)=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C23H22F7NO3/c1-13(32)8-20(33)21(31-3,16-4-6-19(24)7-5-16)12-34-14(2)15-9-17(22(25,26)27)11-18(10-15)23(28,29)30/h4-7,9-11,14,31H,8,12H2,1-3H3/t14-,21-/m1/s1 |
| InChIKey | FANVVBORRJHKAA-SPLOXXLWSA-N |
| XLogP | 5.60 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.42 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|