C22H25BrFNO3 — CID 68723462
1-(4-bromophenyl)ethyl-[4-(4-fluorophenyl)-4-hydroxyhept-6-en-2-yl]carbamic acid (PubChem CID 68723462) has the molecular formula C22H25BrFNO3 and a molecular weight of 450.35 g/mol. Its IUPAC name is 1-(4-bromophenyl)ethyl-[4-(4-fluorophenyl)-4-hydroxyhept-6-en-2-yl]carbamic acid.
| Compound Name | 1-(4-bromophenyl)ethyl-[4-(4-fluorophenyl)-4-hydroxyhept-6-en-2-yl]carbamic acid |
|---|---|
| PubChem CID | 68723462 |
| Molecular Formula | C22H25BrFNO3 |
| Molecular Weight | 450.35 g/mol |
| Exact Mass | 449.10 |
| IUPAC Name | 1-(4-bromophenyl)ethyl-[4-(4-fluorophenyl)-4-hydroxyhept-6-en-2-yl]carbamic acid |
| SMILES | C=CCC(O)(CC(C)N(C(=O)O)C(C)c1ccc(Br)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C22H25BrFNO3/c1-4-13-22(28,18-7-11-20(24)12-8-18)14-15(2)25(21(26)27)16(3)17-5-9-19(23)10-6-17/h4-12,15-16,28H,1,13-14H2,2-3H3,(H,26,27) |
| InChIKey | XRVCTTPBQHGMFS-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.35 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|