C16H23FO — CID 143838263
3-butan-2-yl-3-(4-fluorophenyl)hex-5-en-1-ol (PubChem CID 143838263) has the molecular formula C16H23FO and a molecular weight of 250.36 g/mol. Its IUPAC name is 3-butan-2-yl-3-(4-fluorophenyl)hex-5-en-1-ol.
| Compound Name | 3-butan-2-yl-3-(4-fluorophenyl)hex-5-en-1-ol |
|---|---|
| PubChem CID | 143838263 |
| Molecular Formula | C16H23FO |
| Molecular Weight | 250.36 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 3-butan-2-yl-3-(4-fluorophenyl)hex-5-en-1-ol |
| SMILES | C=CCC(CCO)(c1ccc(F)cc1)C(C)CC |
| InChI | InChI=1S/C16H23FO/c1-4-10-16(11-12-18,13(3)5-2)14-6-8-15(17)9-7-14/h4,6-9,13,18H,1,5,10-12H2,2-3H3 |
| InChIKey | VZQLHGWYEDDBML-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.36 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|