C20H30FNO3 — CID 58485267
methyl N-[(2S)-3,3-dimethylbutan-2-yl]-N-[3-(4-fluorophenyl)-3-hydroxyhex-5-enyl]carbamate (PubChem CID 58485267) has the molecular formula C20H30FNO3 and a molecular weight of 351.46 g/mol. Its IUPAC name is methyl N-[(2S)-3,3-dimethylbutan-2-yl]-N-[3-(4-fluorophenyl)-3-hydroxyhex-5-enyl]carbamate.
| Compound Name | methyl N-[(2S)-3,3-dimethylbutan-2-yl]-N-[3-(4-fluorophenyl)-3-hydroxyhex-5-enyl]carbamate |
|---|---|
| PubChem CID | 58485267 |
| Molecular Formula | C20H30FNO3 |
| Molecular Weight | 351.46 g/mol |
| Exact Mass | 351.22 |
| IUPAC Name | methyl N-[(2S)-3,3-dimethylbutan-2-yl]-N-[3-(4-fluorophenyl)-3-hydroxyhex-5-enyl]carbamate |
| SMILES | C=CCC(O)(CCN(C(=O)OC)[C@@H](C)C(C)(C)C)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H30FNO3/c1-7-12-20(24,16-8-10-17(21)11-9-16)13-14-22(18(23)25-6)15(2)19(3,4)5/h7-11,15,24H,1,12-14H2,2-6H3/t15-,20?/m0/s1 |
| InChIKey | UWUYLAQNUUQGHZ-OOJLDXBWSA-N |
| XLogP | 4.48 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.46 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|