C30H43BrN2O3S — CID 173110132
[[(3S)-1-[1-(4-bromophenyl)ethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-5-methyl-3-phenylhex-5-en-3-yl]amino]-tert-butyl-oxidosulfanium (PubChem CID 173110132) has the molecular formula C30H43BrN2O3S and a molecular weight of 591.66 g/mol. Its IUPAC name is [[(3S)-1-[1-(4-bromophenyl)ethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-5-methyl-3-phenylhex-5-en-3-yl]amino]-tert-butyl-oxidosulfanium.
| Compound Name | [[(3S)-1-[1-(4-bromophenyl)ethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-5-methyl-3-phenylhex-5-en-3-yl]amino]-tert-butyl-oxidosulfanium |
|---|---|
| PubChem CID | 173110132 |
| Molecular Formula | C30H43BrN2O3S |
| Molecular Weight | 591.66 g/mol |
| Exact Mass | 590.22 |
| IUPAC Name | [[(3S)-1-[1-(4-bromophenyl)ethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-5-methyl-3-phenylhex-5-en-3-yl]amino]-tert-butyl-oxidosulfanium |
| SMILES | C=C(C)C[C@@](CCN(C(=O)OC(C)(C)C)C(C)c1ccc(Br)cc1)(N[S+]([O-])C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C30H43BrN2O3S/c1-22(2)21-30(25-13-11-10-12-14-25,32-37(35)29(7,8)9)19-20-33(27(34)36-28(4,5)6)23(3)24-15-17-26(31)18-16-24/h10-18,23,32H,1,19-21H2,2-9H3/t23?,30-,37?/m1/s1 |
| InChIKey | KPYAUOLMORSSBX-CNLCMVJTSA-N |
| XLogP | 8.05 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.66 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|