C24H28BrNO3 — CID 66870054
methyl N-[1-(4-bromophenyl)cyclopropyl]-N-(3-hydroxy-5-methyl-3-phenylhex-5-enyl)carbamate (PubChem CID 66870054) has the molecular formula C24H28BrNO3 and a molecular weight of 458.40 g/mol. Its IUPAC name is methyl N-[1-(4-bromophenyl)cyclopropyl]-N-(3-hydroxy-5-methyl-3-phenylhex-5-enyl)carbamate.
| Compound Name | methyl N-[1-(4-bromophenyl)cyclopropyl]-N-(3-hydroxy-5-methyl-3-phenylhex-5-enyl)carbamate |
|---|---|
| PubChem CID | 66870054 |
| Molecular Formula | C24H28BrNO3 |
| Molecular Weight | 458.40 g/mol |
| Exact Mass | 457.13 |
| IUPAC Name | methyl N-[1-(4-bromophenyl)cyclopropyl]-N-(3-hydroxy-5-methyl-3-phenylhex-5-enyl)carbamate |
| SMILES | C=C(C)CC(O)(CCN(C(=O)OC)C1(c2ccc(Br)cc2)CC1)c1ccccc1 |
| InChI | InChI=1S/C24H28BrNO3/c1-18(2)17-24(28,20-7-5-4-6-8-20)15-16-26(22(27)29-3)23(13-14-23)19-9-11-21(25)12-10-19/h4-12,28H,1,13-17H2,2-3H3 |
| InChIKey | SSXBOBCVXCLJOM-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.40 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|