C23H41NO2Si — CID 67445486
1-[[3-[tert-butyl(dimethyl)silyl]oxy-3-methylbutan-2-yl]amino]-3-phenylhex-5-en-3-ol (PubChem CID 67445486) has the molecular formula C23H41NO2Si and a molecular weight of 391.67 g/mol. Its IUPAC name is 1-[[3-[tert-butyl(dimethyl)silyl]oxy-3-methylbutan-2-yl]amino]-3-phenylhex-5-en-3-ol.
| Compound Name | 1-[[3-[tert-butyl(dimethyl)silyl]oxy-3-methylbutan-2-yl]amino]-3-phenylhex-5-en-3-ol |
|---|---|
| PubChem CID | 67445486 |
| Molecular Formula | C23H41NO2Si |
| Molecular Weight | 391.67 g/mol |
| Exact Mass | 391.29 |
| IUPAC Name | 1-[[3-[tert-butyl(dimethyl)silyl]oxy-3-methylbutan-2-yl]amino]-3-phenylhex-5-en-3-ol |
| SMILES | C=CCC(O)(CCNC(C)C(C)(C)O[Si](C)(C)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C23H41NO2Si/c1-10-16-23(25,20-14-12-11-13-15-20)17-18-24-19(2)22(6,7)26-27(8,9)21(3,4)5/h10-15,19,24-25H,1,16-18H2,2-9H3 |
| InChIKey | QQFZSVOKYBZXFL-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.67 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|