C20H26FNO2 — CID 143834699
[2-amino-2-(2-fluorophenyl)cyclohexyl]methanol;phenylmethanol (PubChem CID 143834699) has the molecular formula C20H26FNO2 and a molecular weight of 331.43 g/mol. Its IUPAC name is [2-amino-2-(2-fluorophenyl)cyclohexyl]methanol;phenylmethanol.
| Compound Name | [2-amino-2-(2-fluorophenyl)cyclohexyl]methanol;phenylmethanol |
|---|---|
| PubChem CID | 143834699 |
| Molecular Formula | C20H26FNO2 |
| Molecular Weight | 331.43 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | [2-amino-2-(2-fluorophenyl)cyclohexyl]methanol;phenylmethanol |
| SMILES | NC1(c2ccccc2F)CCCCC1CO.OCc1ccccc1 |
| InChI | InChI=1S/C13H18FNO.C7H8O/c14-12-7-2-1-6-11(12)13(15)8-4-3-5-10(13)9-16;8-6-7-4-2-1-3-5-7/h1-2,6-7,10,16H,3-5,8-9,15H2;1-5,8H,6H2 |
| InChIKey | VPASJQNPXVRYBI-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.43 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |