About 1-cyclohexyl-4-fluorobenzene;phenylmethanol
1-cyclohexyl-4-fluorobenzene;phenylmethanol (PubChem CID 143134294) has the molecular formula C19H23FO
and a molecular weight of 286.39 g/mol. Its IUPAC name is 1-cyclohexyl-4-fluorobenzene;phenylmethanol.
Molecular Properties
| Compound Name | 1-cyclohexyl-4-fluorobenzene;phenylmethanol |
| PubChem CID | 143134294 |
| Molecular Formula | C19H23FO |
| Molecular Weight | 286.39 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | 1-cyclohexyl-4-fluorobenzene;phenylmethanol |
| SMILES | Fc1ccc(C2CCCCC2)cc1.OCc1ccccc1 |
| InChI | InChI=1S/C12H15F.C7H8O/c13-12-8-6-11(7-9-12)10-4-2-1-3-5-10;8-6-7-4-2-1-3-5-7/h6-10H,1-5H2;1-5,8H,6H2 |
| InChIKey | BQSGUUDFYFYBRM-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 286.39 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-cyclohexyl-4-fluorobenzene;phenylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexyl-4-fluorobenzene;phenylmethanol?
The IUPAC name of 1-cyclohexyl-4-fluorobenzene;phenylmethanol (CID 143134294) is 1-cyclohexyl-4-fluorobenzene;phenylmethanol.
What is the SMILES notation for 1-cyclohexyl-4-fluorobenzene;phenylmethanol?
The canonical SMILES for 1-cyclohexyl-4-fluorobenzene;phenylmethanol is Fc1ccc(C2CCCCC2)cc1.OCc1ccccc1.
What is the InChIKey of 1-cyclohexyl-4-fluorobenzene;phenylmethanol?
The InChIKey is BQSGUUDFYFYBRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15F.C7H8O/c13-12-8-6-11(7-9-12)10-4-2-1-3-5-10;8-6-7-4-2-1-3-5-7/h6-10H,1-5H2;1-5,8H,6H2.
What are the key properties of 1-cyclohexyl-4-fluorobenzene;phenylmethanol?
1-cyclohexyl-4-fluorobenzene;phenylmethanol has a molecular weight of 286.39 g/mol, XLogP of 5.05, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexyl-4-fluorobenzene;phenylmethanol is sourced from PubChem (CID 143134294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).