C22H29F3N4O — CID 143835295
4-cyclodecyl-6-ethoxy-N-[3-(trifluoromethyl)phenyl]-1,3,5-triazin-2-amine (PubChem CID 143835295) has the molecular formula C22H29F3N4O and a molecular weight of 422.50 g/mol. Its IUPAC name is 4-cyclodecyl-6-ethoxy-N-[3-(trifluoromethyl)phenyl]-1,3,5-triazin-2-amine.
| Compound Name | 4-cyclodecyl-6-ethoxy-N-[3-(trifluoromethyl)phenyl]-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 143835295 |
| Molecular Formula | C22H29F3N4O |
| Molecular Weight | 422.50 g/mol |
| Exact Mass | 422.23 |
| IUPAC Name | 4-cyclodecyl-6-ethoxy-N-[3-(trifluoromethyl)phenyl]-1,3,5-triazin-2-amine |
| SMILES | CCOc1nc(Nc2cccc(C(F)(F)F)c2)nc(C2CCCCCCCCC2)n1 |
| InChI | InChI=1S/C22H29F3N4O/c1-2-30-21-28-19(16-11-8-6-4-3-5-7-9-12-16)27-20(29-21)26-18-14-10-13-17(15-18)22(23,24)25/h10,13-16H,2-9,11-12H2,1H3,(H,26,27,28,29) |
| InChIKey | MKTUNHNAKMHGBW-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.50 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |