C20H18F3N5O2 — CID 91245049
3-[[4-ethoxy-6-[3-(trifluoromethyl)anilino]-1,3,5-triazin-2-yl]methyl]benzamide (PubChem CID 91245049) has the molecular formula C20H18F3N5O2 and a molecular weight of 417.39 g/mol. Its IUPAC name is 3-[[4-ethoxy-6-[3-(trifluoromethyl)anilino]-1,3,5-triazin-2-yl]methyl]benzamide.
| Compound Name | 3-[[4-ethoxy-6-[3-(trifluoromethyl)anilino]-1,3,5-triazin-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 91245049 |
| Molecular Formula | C20H18F3N5O2 |
| Molecular Weight | 417.39 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | 3-[[4-ethoxy-6-[3-(trifluoromethyl)anilino]-1,3,5-triazin-2-yl]methyl]benzamide |
| SMILES | CCOc1nc(Cc2cccc(C(N)=O)c2)nc(Nc2cccc(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C20H18F3N5O2/c1-2-30-19-27-16(10-12-5-3-6-13(9-12)17(24)29)26-18(28-19)25-15-8-4-7-14(11-15)20(21,22)23/h3-9,11H,2,10H2,1H3,(H2,24,29)(H,25,26,27,28) |
| InChIKey | YIYVHVMCEPSVBJ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 103.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.39 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |