C9H12N2 — CID 143838539
(Z)-N-(3,4-dihydropyridin-6-yl)but-3-en-2-imine (PubChem CID 143838539) has the molecular formula C9H12N2 and a molecular weight of 148.21 g/mol. Its IUPAC name is (Z)-N-(3,4-dihydropyridin-6-yl)but-3-en-2-imine.
| Compound Name | (Z)-N-(3,4-dihydropyridin-6-yl)but-3-en-2-imine |
|---|---|
| PubChem CID | 143838539 |
| Molecular Formula | C9H12N2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | (Z)-N-(3,4-dihydropyridin-6-yl)but-3-en-2-imine |
| SMILES | C=C/C(C)=N\C1=CCCC=N1 |
| InChI | InChI=1S/C9H12N2/c1-3-8(2)11-9-6-4-5-7-10-9/h3,6-7H,1,4-5H2,2H3/b11-8- |
| InChIKey | PZFBAIGGNGNVBJ-FLIBITNWSA-N |
| XLogP | 2.34 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|