C21H27NO3 — CID 143839085
1-[1-(4-methylphenyl)-1-phenylethoxy]-2-pyrrolidin-2-ylethane-1,1-diol (PubChem CID 143839085) has the molecular formula C21H27NO3 and a molecular weight of 341.45 g/mol. Its IUPAC name is 1-[1-(4-methylphenyl)-1-phenylethoxy]-2-pyrrolidin-2-ylethane-1,1-diol.
| Compound Name | 1-[1-(4-methylphenyl)-1-phenylethoxy]-2-pyrrolidin-2-ylethane-1,1-diol |
|---|---|
| PubChem CID | 143839085 |
| Molecular Formula | C21H27NO3 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | 1-[1-(4-methylphenyl)-1-phenylethoxy]-2-pyrrolidin-2-ylethane-1,1-diol |
| SMILES | Cc1ccc(C(C)(OC(O)(O)CC2CCCN2)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H27NO3/c1-16-10-12-18(13-11-16)20(2,17-7-4-3-5-8-17)25-21(23,24)15-19-9-6-14-22-19/h3-5,7-8,10-13,19,22-24H,6,9,14-15H2,1-2H3 |
| InChIKey | FCKFRRJELPDOFC-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|