C22H24F4N2O — CID 143840699
(E)-N-[(1R)-1-(4-amino-3-fluorophenyl)ethyl]-2-methyl-3-[2-propyl-4-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 143840699) has the molecular formula C22H24F4N2O and a molecular weight of 408.44 g/mol. Its IUPAC name is (E)-N-[(1R)-1-(4-amino-3-fluorophenyl)ethyl]-2-methyl-3-[2-propyl-4-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | (E)-N-[(1R)-1-(4-amino-3-fluorophenyl)ethyl]-2-methyl-3-[2-propyl-4-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 143840699 |
| Molecular Formula | C22H24F4N2O |
| Molecular Weight | 408.44 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | (E)-N-[(1R)-1-(4-amino-3-fluorophenyl)ethyl]-2-methyl-3-[2-propyl-4-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | CCCc1cc(C(F)(F)F)ccc1/C=C(\C)C(=O)N[C@H](C)c1ccc(N)c(F)c1 |
| InChI | InChI=1S/C22H24F4N2O/c1-4-5-16-11-18(22(24,25)26)8-6-17(16)10-13(2)21(29)28-14(3)15-7-9-20(27)19(23)12-15/h6-12,14H,4-5,27H2,1-3H3,(H,28,29)/b13-10+/t14-/m1/s1 |
| InChIKey | ZMRZFJFHLQHPOX-JWAFFJSPSA-N |
| XLogP | 5.66 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.44 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|