C10H16N2 — CID 143841641
(3E,5Z)-3,5-dimethyl-N-(methylideneamino)hepta-1,3,5-trien-4-amine (PubChem CID 143841641) has the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. Its IUPAC name is (3E,5Z)-3,5-dimethyl-N-(methylideneamino)hepta-1,3,5-trien-4-amine.
| Compound Name | (3E,5Z)-3,5-dimethyl-N-(methylideneamino)hepta-1,3,5-trien-4-amine |
|---|---|
| PubChem CID | 143841641 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | (3E,5Z)-3,5-dimethyl-N-(methylideneamino)hepta-1,3,5-trien-4-amine |
| SMILES | C=C/C(C)=C(NN=C)\C(C)=C/C |
| InChI | InChI=1S/C10H16N2/c1-6-8(3)10(12-11-5)9(4)7-2/h6-7,12H,1,5H2,2-4H3/b9-7-,10-8+ |
| InChIKey | VCBZDBVYDPDKKY-FKJILZIQSA-N |
| XLogP | 2.62 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|