C14H16FN3O2S — CID 143842454
(5Z)-2-[ethyl(ethylamino)amino]-5-[(5-fluoro-2-hydroxyphenyl)methylidene]-1,3-thiazol-4-one (PubChem CID 143842454) has the molecular formula C14H16FN3O2S and a molecular weight of 309.37 g/mol. Its IUPAC name is (5Z)-2-[ethyl(ethylamino)amino]-5-[(5-fluoro-2-hydroxyphenyl)methylidene]-1,3-thiazol-4-one.
| Compound Name | (5Z)-2-[ethyl(ethylamino)amino]-5-[(5-fluoro-2-hydroxyphenyl)methylidene]-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 143842454 |
| Molecular Formula | C14H16FN3O2S |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | (5Z)-2-[ethyl(ethylamino)amino]-5-[(5-fluoro-2-hydroxyphenyl)methylidene]-1,3-thiazol-4-one |
| SMILES | CCNN(CC)C1=NC(=O)/C(=C/c2cc(F)ccc2O)S1 |
| InChI | InChI=1S/C14H16FN3O2S/c1-3-16-18(4-2)14-17-13(20)12(21-14)8-9-7-10(15)5-6-11(9)19/h5-8,16,19H,3-4H2,1-2H3/b12-8- |
| InChIKey | WCDZKJAGADEEAP-WQLSENKSSA-N |
| XLogP | 2.35 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|