C6H7NO4 — CID 143843630
(3-oxo-4H-1,4-oxazin-2-yl) acetate (PubChem CID 143843630) has the molecular formula C6H7NO4 and a molecular weight of 157.12 g/mol. Its IUPAC name is (3-oxo-4H-1,4-oxazin-2-yl) acetate.
| Compound Name | (3-oxo-4H-1,4-oxazin-2-yl) acetate |
|---|---|
| PubChem CID | 143843630 |
| Molecular Formula | C6H7NO4 |
| Molecular Weight | 157.12 g/mol |
| Exact Mass | 157.04 |
| IUPAC Name | (3-oxo-4H-1,4-oxazin-2-yl) acetate |
| SMILES | CC(=O)OC1OC=CNC1=O |
| InChI | InChI=1S/C6H7NO4/c1-4(8)11-6-5(9)7-2-3-10-6/h2-3,6H,1H3,(H,7,9) |
| InChIKey | MARDFOMFKUNEFO-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.12 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |