C37H25NS4 — CID 143844008
4-[5-[15-[5-(4-methylphenyl)thiophen-2-yl]-5,14-dithiapentacyclo[10.6.0.03,10.04,8.013,17]octadeca-1,3(10),4(8),6,11,13(17),15-heptaen-6-yl]thiophen-2-yl]aniline (PubChem CID 143844008) has the molecular formula C37H25NS4 and a molecular weight of 611.88 g/mol. Its IUPAC name is 4-[5-[15-[5-(4-methylphenyl)thiophen-2-yl]-5,14-dithiapentacyclo[10.6.0.03,10.04,8.013,17]octadeca-1,3(10),4(8),6,11,13(17),15-heptaen-6-yl]thiophen-2-yl]aniline.
| Compound Name | 4-[5-[15-[5-(4-methylphenyl)thiophen-2-yl]-5,14-dithiapentacyclo[10.6.0.03,10.04,8.013,17]octadeca-1,3(10),4(8),6,11,13(17),15-heptaen-6-yl]thiophen-2-yl]aniline |
|---|---|
| PubChem CID | 143844008 |
| Molecular Formula | C37H25NS4 |
| Molecular Weight | 611.88 g/mol |
| Exact Mass | 611.09 |
| IUPAC Name | 4-[5-[15-[5-(4-methylphenyl)thiophen-2-yl]-5,14-dithiapentacyclo[10.6.0.03,10.04,8.013,17]octadeca-1,3(10),4(8),6,11,13(17),15-heptaen-6-yl]thiophen-2-yl]aniline |
| SMILES | Cc1ccc(-c2ccc(-c3cc4c(s3)-c3cc5c(cc3C4)-c3sc(-c4ccc(-c6ccc(N)cc6)s4)cc3C5)s2)cc1 |
| InChI | InChI=1S/C37H25NS4/c1-20-2-4-21(5-3-20)30-10-12-32(39-30)34-18-25-14-23-17-29-24(16-28(23)36(25)41-34)15-26-19-35(42-37(26)29)33-13-11-31(40-33)22-6-8-27(38)9-7-22/h2-13,16-19H,14-15,38H2,1H3 |
| InChIKey | KLXWMCZOXAWJQD-UHFFFAOYSA-N |
| XLogP | 11.63 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.88 |
| LogP ≤ 5 | 11.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|