C33H16N2S4 — CID 139213214
2-[2-[5-(3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl)thiophen-2-yl]-7-thiophen-2-ylfluoren-9-ylidene]propanedinitrile (PubChem CID 139213214) has the molecular formula C33H16N2S4 and a molecular weight of 568.77 g/mol. Its IUPAC name is 2-[2-[5-(3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl)thiophen-2-yl]-7-thiophen-2-ylfluoren-9-ylidene]propanedinitrile.
| Compound Name | 2-[2-[5-(3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl)thiophen-2-yl]-7-thiophen-2-ylfluoren-9-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 139213214 |
| Molecular Formula | C33H16N2S4 |
| Molecular Weight | 568.77 g/mol |
| Exact Mass | 568.02 |
| IUPAC Name | 2-[2-[5-(3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl)thiophen-2-yl]-7-thiophen-2-ylfluoren-9-ylidene]propanedinitrile |
| SMILES | N#CC(C#N)=C1c2cc(-c3cccs3)ccc2-c2ccc(-c3ccc(-c4cc5c(s4)-c4sccc4C5)s3)cc21 |
| InChI | InChI=1S/C33H16N2S4/c34-16-22(17-35)31-25-13-18(27-2-1-10-36-27)3-5-23(25)24-6-4-19(14-26(24)31)28-7-8-29(38-28)30-15-21-12-20-9-11-37-32(20)33(21)39-30/h1-11,13-15H,12H2 |
| InChIKey | JPOUWVWUGQTAJS-UHFFFAOYSA-N |
| XLogP | 10.33 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.77 |
| LogP ≤ 5 | 10.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|