C20H26N6O5S — CID 143853408
N-[(Z)-1-amino-3-(methylamino)prop-2-enylidene]-4-(1-methoxypropan-2-ylamino)-6-(4-methylsulfonylphenoxy)pyrimidine-2-carboxamide (PubChem CID 143853408) has the molecular formula C20H26N6O5S and a molecular weight of 462.53 g/mol. Its IUPAC name is N-[(Z)-1-amino-3-(methylamino)prop-2-enylidene]-4-(1-methoxypropan-2-ylamino)-6-(4-methylsulfonylphenoxy)pyrimidine-2-carboxamide.
| Compound Name | N-[(Z)-1-amino-3-(methylamino)prop-2-enylidene]-4-(1-methoxypropan-2-ylamino)-6-(4-methylsulfonylphenoxy)pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 143853408 |
| Molecular Formula | C20H26N6O5S |
| Molecular Weight | 462.53 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | N-[(Z)-1-amino-3-(methylamino)prop-2-enylidene]-4-(1-methoxypropan-2-ylamino)-6-(4-methylsulfonylphenoxy)pyrimidine-2-carboxamide |
| SMILES | CN/C=C\C(N)=N\C(=O)c1nc(NC(C)COC)cc(Oc2ccc(S(C)(=O)=O)cc2)n1 |
| InChI | InChI=1S/C20H26N6O5S/c1-13(12-30-3)23-17-11-18(31-14-5-7-15(8-6-14)32(4,28)29)26-19(25-17)20(27)24-16(21)9-10-22-2/h5-11,13,22H,12H2,1-4H3,(H2,21,24,27)(H,23,25,26)/b10-9- |
| InChIKey | VKDLKRVHAZOSKV-KTKRTIGZSA-N |
| XLogP | 1.35 |
| TPSA | 157.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.53 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|