C21H27N5O4S — CID 143853409
N-[(Z)-1-amino-3-(methylamino)prop-2-enylidene]-2-(1-methoxypropan-2-ylamino)-6-(4-methylsulfinylphenoxy)pyridine-4-carboxamide (PubChem CID 143853409) has the molecular formula C21H27N5O4S and a molecular weight of 445.55 g/mol. Its IUPAC name is N-[(Z)-1-amino-3-(methylamino)prop-2-enylidene]-2-(1-methoxypropan-2-ylamino)-6-(4-methylsulfinylphenoxy)pyridine-4-carboxamide.
| Compound Name | N-[(Z)-1-amino-3-(methylamino)prop-2-enylidene]-2-(1-methoxypropan-2-ylamino)-6-(4-methylsulfinylphenoxy)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 143853409 |
| Molecular Formula | C21H27N5O4S |
| Molecular Weight | 445.55 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | N-[(Z)-1-amino-3-(methylamino)prop-2-enylidene]-2-(1-methoxypropan-2-ylamino)-6-(4-methylsulfinylphenoxy)pyridine-4-carboxamide |
| SMILES | CN/C=C\C(N)=N\C(=O)c1cc(NC(C)COC)nc(Oc2ccc(S(C)=O)cc2)c1 |
| InChI | InChI=1S/C21H27N5O4S/c1-14(13-29-3)24-19-11-15(21(27)25-18(22)9-10-23-2)12-20(26-19)30-16-5-7-17(8-6-16)31(4)28/h5-12,14,23H,13H2,1-4H3,(H,24,26)(H2,22,25,27)/b10-9- |
| InChIKey | FHWVXFLFVXXJQQ-KTKRTIGZSA-N |
| XLogP | 2.29 |
| TPSA | 127.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.55 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|