C16H22FN3O2 — CID 143855579
2-[[2-(3-fluoro-2-methylphenyl)-2-methyliminoacetyl]amino]-3,3-dimethylbutanamide (PubChem CID 143855579) has the molecular formula C16H22FN3O2 and a molecular weight of 307.37 g/mol. Its IUPAC name is 2-[[2-(3-fluoro-2-methylphenyl)-2-methyliminoacetyl]amino]-3,3-dimethylbutanamide.
| Compound Name | 2-[[2-(3-fluoro-2-methylphenyl)-2-methyliminoacetyl]amino]-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 143855579 |
| Molecular Formula | C16H22FN3O2 |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | 2-[[2-(3-fluoro-2-methylphenyl)-2-methyliminoacetyl]amino]-3,3-dimethylbutanamide |
| SMILES | C/N=C(\C(=O)NC(C(N)=O)C(C)(C)C)c1cccc(F)c1C |
| InChI | InChI=1S/C16H22FN3O2/c1-9-10(7-6-8-11(9)17)12(19-5)15(22)20-13(14(18)21)16(2,3)4/h6-8,13H,1-5H3,(H2,18,21)(H,20,22)/b19-12- |
| InChIKey | DBLGBKPSSMKOEY-UNOMPAQXSA-N |
| XLogP | 1.57 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|