C25H38F3N3O3 — CID 143855550
3-ethyl-1,1-difluorocyclobutane;2-[[2-(3-fluoro-2-methylphenyl)-2-methyliminoacetyl]amino]-N-(3-hydroxypropyl)-3,3-dimethylbutanamide (PubChem CID 143855550) has the molecular formula C25H38F3N3O3 and a molecular weight of 485.59 g/mol. Its IUPAC name is 3-ethyl-1,1-difluorocyclobutane;2-[[2-(3-fluoro-2-methylphenyl)-2-methyliminoacetyl]amino]-N-(3-hydroxypropyl)-3,3-dimethylbutanamide.
| Compound Name | 3-ethyl-1,1-difluorocyclobutane;2-[[2-(3-fluoro-2-methylphenyl)-2-methyliminoacetyl]amino]-N-(3-hydroxypropyl)-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 143855550 |
| Molecular Formula | C25H38F3N3O3 |
| Molecular Weight | 485.59 g/mol |
| Exact Mass | 485.29 |
| IUPAC Name | 3-ethyl-1,1-difluorocyclobutane;2-[[2-(3-fluoro-2-methylphenyl)-2-methyliminoacetyl]amino]-N-(3-hydroxypropyl)-3,3-dimethylbutanamide |
| SMILES | C/N=C(\C(=O)NC(C(=O)NCCCO)C(C)(C)C)c1cccc(F)c1C.CCC1CC(F)(F)C1 |
| InChI | InChI=1S/C19H28FN3O3.C6H10F2/c1-12-13(8-6-9-14(12)20)15(21-5)17(25)23-16(19(2,3)4)18(26)22-10-7-11-24;1-2-5-3-6(7,8)4-5/h6,8-9,16,24H,7,10-11H2,1-5H3,(H,22,26)(H,23,25);5H,2-4H2,1H3/b21-15-; |
| InChIKey | YSAMUZKFAJEWEV-XGRJIHFXSA-N |
| XLogP | 4.02 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.59 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|