C32H46F3NO2S — CID 143858540
(8S)-9-cyclopentyl-3,6,6-trimethyl-1-[4-(trifluoromethyl)phenyl]-3,5,7,8-tetrahydro-1H-furo[3,4-b]quinolin-8-ol;methylsulfanylethane;propane (PubChem CID 143858540) has the molecular formula C32H46F3NO2S and a molecular weight of 565.79 g/mol. Its IUPAC name is (8S)-9-cyclopentyl-3,6,6-trimethyl-1-[4-(trifluoromethyl)phenyl]-3,5,7,8-tetrahydro-1H-furo[3,4-b]quinolin-8-ol;methylsulfanylethane;propane.
| Compound Name | (8S)-9-cyclopentyl-3,6,6-trimethyl-1-[4-(trifluoromethyl)phenyl]-3,5,7,8-tetrahydro-1H-furo[3,4-b]quinolin-8-ol;methylsulfanylethane;propane |
|---|---|
| PubChem CID | 143858540 |
| Molecular Formula | C32H46F3NO2S |
| Molecular Weight | 565.79 g/mol |
| Exact Mass | 565.32 |
| IUPAC Name | (8S)-9-cyclopentyl-3,6,6-trimethyl-1-[4-(trifluoromethyl)phenyl]-3,5,7,8-tetrahydro-1H-furo[3,4-b]quinolin-8-ol;methylsulfanylethane;propane |
| SMILES | CC1OC(c2ccc(C(F)(F)F)cc2)c2c1nc1c(c2C2CCCC2)[C@@H](O)CC(C)(C)C1.CCC.CCSC |
| InChI | InChI=1S/C26H30F3NO2.C3H8S.C3H8/c1-14-23-22(24(32-14)16-8-10-17(11-9-16)26(27,28)29)20(15-6-4-5-7-15)21-18(30-23)12-25(2,3)13-19(21)31;1-3-4-2;1-3-2/h8-11,14-15,19,24,31H,4-7,12-13H2,1-3H3;3H2,1-2H3;3H2,1-2H3/t14?,19-,24?;;/m0../s1 |
| InChIKey | JNILAUUIUKFVQC-LRJUTHIVSA-N |
| XLogP | 9.73 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.79 |
| LogP ≤ 5 | 9.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |