C26H30F3NO2 — CID 74949143
9-cyclopentyl-3,6,6-trimethyl-1-[4-(trifluoromethyl)phenyl]-3,5,7,8-tetrahydro-1H-furo[3,4-b]quinolin-8-ol (PubChem CID 74949143) has the molecular formula C26H30F3NO2 and a molecular weight of 445.53 g/mol. Its IUPAC name is 9-cyclopentyl-3,6,6-trimethyl-1-[4-(trifluoromethyl)phenyl]-3,5,7,8-tetrahydro-1H-furo[3,4-b]quinolin-8-ol.
| Compound Name | 9-cyclopentyl-3,6,6-trimethyl-1-[4-(trifluoromethyl)phenyl]-3,5,7,8-tetrahydro-1H-furo[3,4-b]quinolin-8-ol |
|---|---|
| PubChem CID | 74949143 |
| Molecular Formula | C26H30F3NO2 |
| Molecular Weight | 445.53 g/mol |
| Exact Mass | 445.22 |
| IUPAC Name | 9-cyclopentyl-3,6,6-trimethyl-1-[4-(trifluoromethyl)phenyl]-3,5,7,8-tetrahydro-1H-furo[3,4-b]quinolin-8-ol |
| SMILES | CC1OC(c2ccc(C(F)(F)F)cc2)c2c1nc1c(c2C2CCCC2)C(O)CC(C)(C)C1 |
| InChI | InChI=1S/C26H30F3NO2/c1-14-23-22(24(32-14)16-8-10-17(11-9-16)26(27,28)29)20(15-6-4-5-7-15)21-18(30-23)12-25(2,3)13-19(21)31/h8-11,14-15,19,24,31H,4-7,12-13H2,1-3H3 |
| InChIKey | UCSOKFMCUQKXSB-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.53 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |