C19H33NO — CID 143858827
(9Z,12Z)-N-methylideneoctadeca-9,12-dienamide (PubChem CID 143858827) has the molecular formula C19H33NO and a molecular weight of 291.48 g/mol. Its IUPAC name is (9Z,12Z)-N-methylideneoctadeca-9,12-dienamide.
| Compound Name | (9Z,12Z)-N-methylideneoctadeca-9,12-dienamide |
|---|---|
| PubChem CID | 143858827 |
| Molecular Formula | C19H33NO |
| Molecular Weight | 291.48 g/mol |
| Exact Mass | 291.26 |
| IUPAC Name | (9Z,12Z)-N-methylideneoctadeca-9,12-dienamide |
| SMILES | C=NC(=O)CCCCCCC/C=C\C/C=C\CCCCC |
| InChI | InChI=1S/C19H33NO/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(21)20-2/h7-8,10-11H,2-6,9,12-18H2,1H3/b8-7-,11-10- |
| InChIKey | ARCACXGSUYEXMB-NQLNTKRDSA-N |
| XLogP | 6.03 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.48 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|