C26H22Cl2FNO — CID 143864159
(1R,6S)-1-(2-amino-4-chlorophenyl)-6-(3-chlorophenyl)-3-(5-fluoro-2-methylphenyl)cyclohex-2-ene-1-carbaldehyde (PubChem CID 143864159) has the molecular formula C26H22Cl2FNO and a molecular weight of 454.37 g/mol. Its IUPAC name is (1R,6S)-1-(2-amino-4-chlorophenyl)-6-(3-chlorophenyl)-3-(5-fluoro-2-methylphenyl)cyclohex-2-ene-1-carbaldehyde.
| Compound Name | (1R,6S)-1-(2-amino-4-chlorophenyl)-6-(3-chlorophenyl)-3-(5-fluoro-2-methylphenyl)cyclohex-2-ene-1-carbaldehyde |
|---|---|
| PubChem CID | 143864159 |
| Molecular Formula | C26H22Cl2FNO |
| Molecular Weight | 454.37 g/mol |
| Exact Mass | 453.11 |
| IUPAC Name | (1R,6S)-1-(2-amino-4-chlorophenyl)-6-(3-chlorophenyl)-3-(5-fluoro-2-methylphenyl)cyclohex-2-ene-1-carbaldehyde |
| SMILES | Cc1ccc(F)cc1C1=C[C@](C=O)(c2ccc(Cl)cc2N)[C@H](c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C26H22Cl2FNO/c1-16-5-8-21(29)13-22(16)18-6-9-23(17-3-2-4-19(27)11-17)26(14-18,15-31)24-10-7-20(28)12-25(24)30/h2-5,7-8,10-15,23H,6,9,30H2,1H3/t23-,26+/m0/s1 |
| InChIKey | GTXSSAVUIQMDHA-JYFHCDHNSA-N |
| XLogP | 7.12 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.37 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|