C19H14Cl3NO2 — CID 163751294
(1R)-1-(2-amino-4-chlorophenyl)-6-(3,5-dichlorophenyl)-4-oxocyclohex-2-ene-1-carbaldehyde (PubChem CID 163751294) has the molecular formula C19H14Cl3NO2 and a molecular weight of 394.69 g/mol. Its IUPAC name is (1R)-1-(2-amino-4-chlorophenyl)-6-(3,5-dichlorophenyl)-4-oxocyclohex-2-ene-1-carbaldehyde.
| Compound Name | (1R)-1-(2-amino-4-chlorophenyl)-6-(3,5-dichlorophenyl)-4-oxocyclohex-2-ene-1-carbaldehyde |
|---|---|
| PubChem CID | 163751294 |
| Molecular Formula | C19H14Cl3NO2 |
| Molecular Weight | 394.69 g/mol |
| Exact Mass | 393.01 |
| IUPAC Name | (1R)-1-(2-amino-4-chlorophenyl)-6-(3,5-dichlorophenyl)-4-oxocyclohex-2-ene-1-carbaldehyde |
| SMILES | Nc1cc(Cl)ccc1[C@@]1(C=O)C=CC(=O)CC1c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C19H14Cl3NO2/c20-12-1-2-16(18(23)8-12)19(10-24)4-3-15(25)9-17(19)11-5-13(21)7-14(22)6-11/h1-8,10,17H,9,23H2/t17?,19-/m0/s1 |
| InChIKey | LQENYYVJUKTGDL-NNBQYGFHSA-N |
| XLogP | 4.98 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.69 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|