C25H24N4O — CID 143864394
N-[[5-(2-phenylethyl)-4-[(4-phenylphenyl)methyl]-1,2,4-triazol-3-yl]methyl]formamide (PubChem CID 143864394) has the molecular formula C25H24N4O and a molecular weight of 396.49 g/mol. Its IUPAC name is N-[[5-(2-phenylethyl)-4-[(4-phenylphenyl)methyl]-1,2,4-triazol-3-yl]methyl]formamide.
| Compound Name | N-[[5-(2-phenylethyl)-4-[(4-phenylphenyl)methyl]-1,2,4-triazol-3-yl]methyl]formamide |
|---|---|
| PubChem CID | 143864394 |
| Molecular Formula | C25H24N4O |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | N-[[5-(2-phenylethyl)-4-[(4-phenylphenyl)methyl]-1,2,4-triazol-3-yl]methyl]formamide |
| SMILES | O=CNCc1nnc(CCc2ccccc2)n1Cc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C25H24N4O/c30-19-26-17-25-28-27-24(16-13-20-7-3-1-4-8-20)29(25)18-21-11-14-23(15-12-21)22-9-5-2-6-10-22/h1-12,14-15,19H,13,16-18H2,(H,26,30) |
| InChIKey | KKFRHXXZRAVSBC-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|