C20H35N — CID 143866472
(5E,7Z)-5-ethenyl-N-ethyl-3-methyl-N-propylnona-1,5,7-trien-4-amine;prop-1-ene (PubChem CID 143866472) has the molecular formula C20H35N and a molecular weight of 289.51 g/mol. Its IUPAC name is (5E,7Z)-5-ethenyl-N-ethyl-3-methyl-N-propylnona-1,5,7-trien-4-amine;prop-1-ene.
| Compound Name | (5E,7Z)-5-ethenyl-N-ethyl-3-methyl-N-propylnona-1,5,7-trien-4-amine;prop-1-ene |
|---|---|
| PubChem CID | 143866472 |
| Molecular Formula | C20H35N |
| Molecular Weight | 289.51 g/mol |
| Exact Mass | 289.28 |
| IUPAC Name | (5E,7Z)-5-ethenyl-N-ethyl-3-methyl-N-propylnona-1,5,7-trien-4-amine;prop-1-ene |
| SMILES | C=C/C(=C\C=C/C)C(C(C)C=C)N(CC)CCC.C=CC |
| InChI | InChI=1S/C17H29N.C3H6/c1-7-12-13-16(10-4)17(15(6)9-3)18(11-5)14-8-2;1-3-2/h7,9-10,12-13,15,17H,3-4,8,11,14H2,1-2,5-6H3;3H,1H2,2H3/b12-7-,16-13+; |
| InChIKey | KQZOKZRLAZVDAM-DSJYLXBTSA-N |
| XLogP | 5.79 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.51 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|