C16H29NO2 — CID 143866566
(4Z)-4-[(Z)-2,3-dimethoxybut-2-enylidene]-3-ethenyl-1-methylpiperidine;ethane (PubChem CID 143866566) has the molecular formula C16H29NO2 and a molecular weight of 267.41 g/mol. Its IUPAC name is (4Z)-4-[(Z)-2,3-dimethoxybut-2-enylidene]-3-ethenyl-1-methylpiperidine;ethane.
| Compound Name | (4Z)-4-[(Z)-2,3-dimethoxybut-2-enylidene]-3-ethenyl-1-methylpiperidine;ethane |
|---|---|
| PubChem CID | 143866566 |
| Molecular Formula | C16H29NO2 |
| Molecular Weight | 267.41 g/mol |
| Exact Mass | 267.22 |
| IUPAC Name | (4Z)-4-[(Z)-2,3-dimethoxybut-2-enylidene]-3-ethenyl-1-methylpiperidine;ethane |
| SMILES | C=CC1CN(C)CC/C1=C/C(OC)=C(\C)OC.CC |
| InChI | InChI=1S/C14H23NO2.C2H6/c1-6-12-10-15(3)8-7-13(12)9-14(17-5)11(2)16-4;1-2/h6,9,12H,1,7-8,10H2,2-5H3;1-2H3/b13-9-,14-11-; |
| InChIKey | DXNYUAVQEIUGHX-ZITZHUFQSA-N |
| XLogP | 3.60 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.41 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|