C24H43N3O5S2 — CID 143867101
ethane;3-[1-[(Z)-ethylideneamino]penta-2,4-dienyldisulfanyl]propanal;[methyl(4-oxobutanoyl)amino] 6-(methylamino)hexanoate (PubChem CID 143867101) has the molecular formula C24H43N3O5S2 and a molecular weight of 517.76 g/mol. Its IUPAC name is ethane;3-[1-[(Z)-ethylideneamino]penta-2,4-dienyldisulfanyl]propanal;[methyl(4-oxobutanoyl)amino] 6-(methylamino)hexanoate.
| Compound Name | ethane;3-[1-[(Z)-ethylideneamino]penta-2,4-dienyldisulfanyl]propanal;[methyl(4-oxobutanoyl)amino] 6-(methylamino)hexanoate |
|---|---|
| PubChem CID | 143867101 |
| Molecular Formula | C24H43N3O5S2 |
| Molecular Weight | 517.76 g/mol |
| Exact Mass | 517.26 |
| IUPAC Name | ethane;3-[1-[(Z)-ethylideneamino]penta-2,4-dienyldisulfanyl]propanal;[methyl(4-oxobutanoyl)amino] 6-(methylamino)hexanoate |
| SMILES | C=CC=CC(/N=C\C)SSCCC=O.CC.CNCCCCCC(=O)ON(C)C(=O)CCC=O |
| InChI | InChI=1S/C12H22N2O4.C10H15NOS2.C2H6/c1-13-9-5-3-4-8-12(17)18-14(2)11(16)7-6-10-15;1-3-5-7-10(11-4-2)14-13-9-6-8-12;1-2/h10,13H,3-9H2,1-2H3;3-5,7-8,10H,1,6,9H2,2H3;1-2H3/b;7-5?,11-4-; |
| InChIKey | RYSHQBVCJJGDJN-BUKUFYDKSA-N |
| XLogP | 4.80 |
| TPSA | 105.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.76 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|