C29H48N6O14 — CID 138528935
2-[[2-[[4-carboxy-2-[[2-[3-[2-[3-[methyl(4-oxobutanoyl)amino]oxy-3-oxopropoxy]ethoxy]propanoylamino]acetyl]amino]butanoyl]amino]acetyl]amino]-6-(methylamino)hexanoic acid (PubChem CID 138528935) has the molecular formula C29H48N6O14 and a molecular weight of 704.73 g/mol. Its IUPAC name is 2-[[2-[[4-carboxy-2-[[2-[3-[2-[3-[methyl(4-oxobutanoyl)amino]oxy-3-oxopropoxy]ethoxy]propanoylamino]acetyl]amino]butanoyl]amino]acetyl]amino]-6-(methylamino)hexanoic acid.
| Compound Name | 2-[[2-[[4-carboxy-2-[[2-[3-[2-[3-[methyl(4-oxobutanoyl)amino]oxy-3-oxopropoxy]ethoxy]propanoylamino]acetyl]amino]butanoyl]amino]acetyl]amino]-6-(methylamino)hexanoic acid |
|---|---|
| PubChem CID | 138528935 |
| Molecular Formula | C29H48N6O14 |
| Molecular Weight | 704.73 g/mol |
| Exact Mass | 704.32 |
| IUPAC Name | 2-[[2-[[4-carboxy-2-[[2-[3-[2-[3-[methyl(4-oxobutanoyl)amino]oxy-3-oxopropoxy]ethoxy]propanoylamino]acetyl]amino]butanoyl]amino]acetyl]amino]-6-(methylamino)hexanoic acid |
| SMILES | CNCCCCC(NC(=O)CNC(=O)C(CCC(=O)O)NC(=O)CNC(=O)CCOCCOCCC(=O)ON(C)C(=O)CCC=O)C(=O)O |
| InChI | InChI=1S/C29H48N6O14/c1-30-12-4-3-6-21(29(45)46)34-24(39)19-32-28(44)20(8-9-26(41)42)33-23(38)18-31-22(37)10-14-47-16-17-48-15-11-27(43)49-35(2)25(40)7-5-13-36/h13,20-21,30H,3-12,14-19H2,1-2H3,(H,31,37)(H,32,44)(H,33,38)(H,34,39)(H,41,42)(H,45,46) |
| InChIKey | NROFALMWTIBKKE-UHFFFAOYSA-N |
| XLogP | -2.76 |
| TPSA | 285.17 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.73 |
| LogP ≤ 5 | -2.76 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|