C20H27BrN4O2 — CID 143867987
(E)-3-[4-[[2-(4-bromo-3,5-dimethylpyrazol-1-yl)ethyl-propylamino]methyl]phenyl]-N-hydroxyprop-2-enamide (PubChem CID 143867987) has the molecular formula C20H27BrN4O2 and a molecular weight of 435.37 g/mol. Its IUPAC name is (E)-3-[4-[[2-(4-bromo-3,5-dimethylpyrazol-1-yl)ethyl-propylamino]methyl]phenyl]-N-hydroxyprop-2-enamide.
| Compound Name | (E)-3-[4-[[2-(4-bromo-3,5-dimethylpyrazol-1-yl)ethyl-propylamino]methyl]phenyl]-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 143867987 |
| Molecular Formula | C20H27BrN4O2 |
| Molecular Weight | 435.37 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | (E)-3-[4-[[2-(4-bromo-3,5-dimethylpyrazol-1-yl)ethyl-propylamino]methyl]phenyl]-N-hydroxyprop-2-enamide |
| SMILES | CCCN(CCn1nc(C)c(Br)c1C)Cc1ccc(/C=C/C(=O)NO)cc1 |
| InChI | InChI=1S/C20H27BrN4O2/c1-4-11-24(12-13-25-16(3)20(21)15(2)22-25)14-18-7-5-17(6-8-18)9-10-19(26)23-27/h5-10,27H,4,11-14H2,1-3H3,(H,23,26)/b10-9+ |
| InChIKey | ILFQMLDLKYLJBY-MDZDMXLPSA-N |
| XLogP | 3.69 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.37 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|