C28H28N6O2 — CID 20579462
(E)-3-[4-[[bis(2-pyrrolo[2,3-b]pyridin-1-ylethyl)amino]methyl]phenyl]-N-hydroxyprop-2-enamide (PubChem CID 20579462) has the molecular formula C28H28N6O2 and a molecular weight of 480.57 g/mol. Its IUPAC name is (E)-3-[4-[[bis(2-pyrrolo[2,3-b]pyridin-1-ylethyl)amino]methyl]phenyl]-N-hydroxyprop-2-enamide.
| Compound Name | (E)-3-[4-[[bis(2-pyrrolo[2,3-b]pyridin-1-ylethyl)amino]methyl]phenyl]-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 20579462 |
| Molecular Formula | C28H28N6O2 |
| Molecular Weight | 480.57 g/mol |
| Exact Mass | 480.23 |
| IUPAC Name | (E)-3-[4-[[bis(2-pyrrolo[2,3-b]pyridin-1-ylethyl)amino]methyl]phenyl]-N-hydroxyprop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(CN(CCn2ccc3cccnc32)CCn2ccc3cccnc32)cc1)NO |
| InChI | InChI=1S/C28H28N6O2/c35-26(31-36)10-9-22-5-7-23(8-6-22)21-32(17-19-33-15-11-24-3-1-13-29-27(24)33)18-20-34-16-12-25-4-2-14-30-28(25)34/h1-16,36H,17-21H2,(H,31,35)/b10-9+ |
| InChIKey | PGGZNSLHNUYOKJ-MDZDMXLPSA-N |
| XLogP | 4.11 |
| TPSA | 88.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.57 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|