C26H30N4O2 — CID 143870942
N,N-dimethylmethanamine;2-[2-[(4-formylphenyl)methylamino]phenyl]-2-imino-N-(4-methylphenyl)acetamide (PubChem CID 143870942) has the molecular formula C26H30N4O2 and a molecular weight of 430.55 g/mol. Its IUPAC name is N,N-dimethylmethanamine;2-[2-[(4-formylphenyl)methylamino]phenyl]-2-imino-N-(4-methylphenyl)acetamide.
| Compound Name | N,N-dimethylmethanamine;2-[2-[(4-formylphenyl)methylamino]phenyl]-2-imino-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 143870942 |
| Molecular Formula | C26H30N4O2 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | N,N-dimethylmethanamine;2-[2-[(4-formylphenyl)methylamino]phenyl]-2-imino-N-(4-methylphenyl)acetamide |
| SMILES | CN(C)C.[H]/N=C(\C(=O)Nc1ccc(C)cc1)c1ccccc1NCc1ccc(C=O)cc1 |
| InChI | InChI=1S/C23H21N3O2.C3H9N/c1-16-6-12-19(13-7-16)26-23(28)22(24)20-4-2-3-5-21(20)25-14-17-8-10-18(15-27)11-9-17;1-4(2)3/h2-13,15,24-25H,14H2,1H3,(H,26,28);1-3H3/b24-22-; |
| InChIKey | KZNHXAWVWZLPHE-WKKHQKTCSA-N |
| XLogP | 4.60 |
| TPSA | 85.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|