C14H18N4OS2 — CID 143880092
N-[4-[(5-tert-butyl-1,3,4-thiadiazol-2-yl)amino]sulfanylphenyl]acetamide (PubChem CID 143880092) has the molecular formula C14H18N4OS2 and a molecular weight of 322.46 g/mol. Its IUPAC name is N-[4-[(5-tert-butyl-1,3,4-thiadiazol-2-yl)amino]sulfanylphenyl]acetamide.
| Compound Name | N-[4-[(5-tert-butyl-1,3,4-thiadiazol-2-yl)amino]sulfanylphenyl]acetamide |
|---|---|
| PubChem CID | 143880092 |
| Molecular Formula | C14H18N4OS2 |
| Molecular Weight | 322.46 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | N-[4-[(5-tert-butyl-1,3,4-thiadiazol-2-yl)amino]sulfanylphenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(SNc2nnc(C(C)(C)C)s2)cc1 |
| InChI | InChI=1S/C14H18N4OS2/c1-9(19)15-10-5-7-11(8-6-10)21-18-13-17-16-12(20-13)14(2,3)4/h5-8H,1-4H3,(H,15,19)(H,17,18) |
| InChIKey | UYXDKSQXKOXXHD-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.46 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|