C20H28N4O2S — CID 2024828
N-(4-butylphenyl)-N'-(5-tert-butyl-1,3,4-thiadiazol-2-yl)butanediamide (PubChem CID 2024828) has the molecular formula C20H28N4O2S and a molecular weight of 388.54 g/mol. Its IUPAC name is N-(4-butylphenyl)-N'-(5-tert-butyl-1,3,4-thiadiazol-2-yl)butanediamide.
| Compound Name | N-(4-butylphenyl)-N'-(5-tert-butyl-1,3,4-thiadiazol-2-yl)butanediamide |
|---|---|
| PubChem CID | 2024828 |
| Molecular Formula | C20H28N4O2S |
| Molecular Weight | 388.54 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | N-(4-butylphenyl)-N'-(5-tert-butyl-1,3,4-thiadiazol-2-yl)butanediamide |
| SMILES | CCCCc1ccc(NC(=O)CCC(=O)Nc2nnc(C(C)(C)C)s2)cc1 |
| InChI | InChI=1S/C20H28N4O2S/c1-5-6-7-14-8-10-15(11-9-14)21-16(25)12-13-17(26)22-19-24-23-18(27-19)20(2,3)4/h8-11H,5-7,12-13H2,1-4H3,(H,21,25)(H,22,24,26) |
| InChIKey | VYUKLDBSUNDMBN-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.54 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |