C29H33N3 — CID 143881833
4-(4-butylphenyl)-6-methyl-2-(4-methylphenyl)pyrimidine;N-methylaniline (PubChem CID 143881833) has the molecular formula C29H33N3 and a molecular weight of 423.60 g/mol. Its IUPAC name is 4-(4-butylphenyl)-6-methyl-2-(4-methylphenyl)pyrimidine;N-methylaniline.
| Compound Name | 4-(4-butylphenyl)-6-methyl-2-(4-methylphenyl)pyrimidine;N-methylaniline |
|---|---|
| PubChem CID | 143881833 |
| Molecular Formula | C29H33N3 |
| Molecular Weight | 423.60 g/mol |
| Exact Mass | 423.27 |
| IUPAC Name | 4-(4-butylphenyl)-6-methyl-2-(4-methylphenyl)pyrimidine;N-methylaniline |
| SMILES | CCCCc1ccc(-c2cc(C)nc(-c3ccc(C)cc3)n2)cc1.CNc1ccccc1 |
| InChI | InChI=1S/C22H24N2.C7H9N/c1-4-5-6-18-9-13-19(14-10-18)21-15-17(3)23-22(24-21)20-11-7-16(2)8-12-20;1-8-7-5-3-2-4-6-7/h7-15H,4-6H2,1-3H3;2-6,8H,1H3 |
| InChIKey | WMNXGZQPVKHHNN-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.60 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |