C28H32N4O4S2 — CID 143885562
hydrogen peroxide;methanethiol;methyl N-[4-[[6-(3-methylphenyl)-1,3-benzothiazol-2-yl]carbamoylamino]but-1-en-2-yl]benzenecarboximidate (PubChem CID 143885562) has the molecular formula C28H32N4O4S2 and a molecular weight of 552.72 g/mol. Its IUPAC name is hydrogen peroxide;methanethiol;methyl N-[4-[[6-(3-methylphenyl)-1,3-benzothiazol-2-yl]carbamoylamino]but-1-en-2-yl]benzenecarboximidate.
| Compound Name | hydrogen peroxide;methanethiol;methyl N-[4-[[6-(3-methylphenyl)-1,3-benzothiazol-2-yl]carbamoylamino]but-1-en-2-yl]benzenecarboximidate |
|---|---|
| PubChem CID | 143885562 |
| Molecular Formula | C28H32N4O4S2 |
| Molecular Weight | 552.72 g/mol |
| Exact Mass | 552.19 |
| IUPAC Name | hydrogen peroxide;methanethiol;methyl N-[4-[[6-(3-methylphenyl)-1,3-benzothiazol-2-yl]carbamoylamino]but-1-en-2-yl]benzenecarboximidate |
| SMILES | C=C(CCNC(=O)Nc1nc2ccc(-c3cccc(C)c3)cc2s1)/N=C(\OC)c1ccccc1.CS.OO |
| InChI | InChI=1S/C27H26N4O2S.CH4S.H2O2/c1-18-8-7-11-21(16-18)22-12-13-23-24(17-22)34-27(30-23)31-26(32)28-15-14-19(2)29-25(33-3)20-9-5-4-6-10-20;2*1-2/h4-13,16-17H,2,14-15H2,1,3H3,(H2,28,30,31,32);2H,1H3;1-2H/b29-25-;; |
| InChIKey | HLIZMVVZQAHCBI-LEJUFYTLSA-N |
| XLogP | 6.95 |
| TPSA | 116.07 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.72 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|