C17H30 — CID 143887968
(1S,4S,4aR,6S,8aR)-8a-ethenyl-1,6-dimethyl-4-propan-2-yl-2,3,4,4a,5,6,7,8-octahydro-1H-naphthalene (PubChem CID 143887968) has the molecular formula C17H30 and a molecular weight of 234.43 g/mol. Its IUPAC name is (1S,4S,4aR,6S,8aR)-8a-ethenyl-1,6-dimethyl-4-propan-2-yl-2,3,4,4a,5,6,7,8-octahydro-1H-naphthalene.
| Compound Name | (1S,4S,4aR,6S,8aR)-8a-ethenyl-1,6-dimethyl-4-propan-2-yl-2,3,4,4a,5,6,7,8-octahydro-1H-naphthalene |
|---|---|
| PubChem CID | 143887968 |
| Molecular Formula | C17H30 |
| Molecular Weight | 234.43 g/mol |
| Exact Mass | 234.23 |
| IUPAC Name | (1S,4S,4aR,6S,8aR)-8a-ethenyl-1,6-dimethyl-4-propan-2-yl-2,3,4,4a,5,6,7,8-octahydro-1H-naphthalene |
| SMILES | C=C[C@@]12CC[C@H](C)C[C@@H]1[C@H](C(C)C)CC[C@@H]2C |
| InChI | InChI=1S/C17H30/c1-6-17-10-9-13(4)11-16(17)15(12(2)3)8-7-14(17)5/h6,12-16H,1,7-11H2,2-5H3/t13-,14-,15-,16+,17-/m0/s1 |
| InChIKey | HQFZLKLLUKFGHE-VIQHNZTISA-N |
| XLogP | 5.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.43 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|