C32H59N — CID 66873940
2-ethenyl-5-methyl-N,N-bis(5-methyl-2-propan-2-ylcyclohexyl)-2-propan-2-ylcyclohexan-1-amine (PubChem CID 66873940) has the molecular formula C32H59N and a molecular weight of 457.83 g/mol. Its IUPAC name is 2-ethenyl-5-methyl-N,N-bis(5-methyl-2-propan-2-ylcyclohexyl)-2-propan-2-ylcyclohexan-1-amine.
| Compound Name | 2-ethenyl-5-methyl-N,N-bis(5-methyl-2-propan-2-ylcyclohexyl)-2-propan-2-ylcyclohexan-1-amine |
|---|---|
| PubChem CID | 66873940 |
| Molecular Formula | C32H59N |
| Molecular Weight | 457.83 g/mol |
| Exact Mass | 457.46 |
| IUPAC Name | 2-ethenyl-5-methyl-N,N-bis(5-methyl-2-propan-2-ylcyclohexyl)-2-propan-2-ylcyclohexan-1-amine |
| SMILES | C=CC1(C(C)C)CCC(C)CC1N(C1CC(C)CCC1C(C)C)C1CC(C)CCC1C(C)C |
| InChI | InChI=1S/C32H59N/c1-11-32(23(6)7)17-16-26(10)20-31(32)33(29-18-24(8)12-14-27(29)21(2)3)30-19-25(9)13-15-28(30)22(4)5/h11,21-31H,1,12-20H2,2-10H3 |
| InChIKey | RULPLYHTPCPJFD-UHFFFAOYSA-N |
| XLogP | 9.23 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.83 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|