C28H46 — CID 154432763
5-ethenyl-1,5-bis(5-methyl-2-propan-2-ylcyclohexyl)cyclohexa-1,3-diene (PubChem CID 154432763) has the molecular formula C28H46 and a molecular weight of 382.68 g/mol. Its IUPAC name is 5-ethenyl-1,5-bis(5-methyl-2-propan-2-ylcyclohexyl)cyclohexa-1,3-diene.
| Compound Name | 5-ethenyl-1,5-bis(5-methyl-2-propan-2-ylcyclohexyl)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 154432763 |
| Molecular Formula | C28H46 |
| Molecular Weight | 382.68 g/mol |
| Exact Mass | 382.36 |
| IUPAC Name | 5-ethenyl-1,5-bis(5-methyl-2-propan-2-ylcyclohexyl)cyclohexa-1,3-diene |
| SMILES | C=CC1(C2CC(C)CCC2C(C)C)C=CC=C(C2CC(C)CCC2C(C)C)C1 |
| InChI | InChI=1S/C28H46/c1-8-28(27-17-22(7)12-14-25(27)20(4)5)15-9-10-23(18-28)26-16-21(6)11-13-24(26)19(2)3/h8-10,15,19-22,24-27H,1,11-14,16-18H2,2-7H3 |
| InChIKey | WJZRWOQBAZDIIP-UHFFFAOYSA-N |
| XLogP | 8.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.68 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|