C19H25 — CID 134992473
CID 134992473 (PubChem CID 134992473) has the molecular formula C19H25 and a molecular weight of 253.41 g/mol.
| Compound Name | CID 134992473 |
|---|---|
| PubChem CID | 134992473 |
| Molecular Formula | C19H25 |
| Molecular Weight | 253.41 g/mol |
| Exact Mass | 253.20 |
| IUPAC Name | — |
| SMILES | CC(C)[C@H]1CC[C@@H](C)C[C@@H]1[C]1[CH][CH][C]2C=CC=C[C]21 |
| InChI | InChI=1S/C19H25/c1-13(2)16-10-8-14(3)12-19(16)18-11-9-15-6-4-5-7-17(15)18/h4-7,9,11,13-14,16,19H,8,10,12H2,1-3H3/t14-,16-,19+/m1/s1 |
| InChIKey | GFSIHFJDDSLUAW-OGWOLHLISA-N |
| XLogP | 4.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.41 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |