C17H32Li2Si — CID 174397968
dilithium;dimethyl-[3-(5-methyl-2-propan-2-ylcyclohexyl)cyclopenta-2,4-dien-1-yl]silane;hydride (PubChem CID 174397968) has the molecular formula C17H32Li2Si and a molecular weight of 278.41 g/mol. Its IUPAC name is dilithium;dimethyl-[3-(5-methyl-2-propan-2-ylcyclohexyl)cyclopenta-2,4-dien-1-yl]silane;hydride.
| Compound Name | dilithium;dimethyl-[3-(5-methyl-2-propan-2-ylcyclohexyl)cyclopenta-2,4-dien-1-yl]silane;hydride |
|---|---|
| PubChem CID | 174397968 |
| Molecular Formula | C17H32Li2Si |
| Molecular Weight | 278.41 g/mol |
| Exact Mass | 278.26 |
| IUPAC Name | dilithium;dimethyl-[3-(5-methyl-2-propan-2-ylcyclohexyl)cyclopenta-2,4-dien-1-yl]silane;hydride |
| SMILES | CC1CCC(C(C)C)C(C2=CC([SiH](C)C)C=C2)C1.[H-].[H-].[Li+].[Li+] |
| InChI | InChI=1S/C17H30Si.2Li.2H/c1-12(2)16-9-6-13(3)10-17(16)14-7-8-15(11-14)18(4)5;;;;/h7-8,11-13,15-18H,6,9-10H2,1-5H3;;;;/q;2*+1;2*-1 |
| InChIKey | OTSBXCBWXSDKKS-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.41 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|