C30H36Si — CID 10962980
CID 10962980 (PubChem CID 10962980) has the molecular formula C30H36Si and a molecular weight of 424.70 g/mol.
| Compound Name | CID 10962980 |
|---|---|
| PubChem CID | 10962980 |
| Molecular Formula | C30H36Si |
| Molecular Weight | 424.70 g/mol |
| Exact Mass | 424.26 |
| IUPAC Name | — |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1[C]1[CH][CH][C]([Si](C)(C)[C]2[C]3C=CC=C[C]3[C]3C=CC=C[C]32)[CH]1 |
| InChI | InChI=1S/C30H36Si/c1-20(2)24-17-14-21(3)18-29(24)22-15-16-23(19-22)31(4,5)30-27-12-8-6-10-25(27)26-11-7-9-13-28(26)30/h6-13,15-16,19-21,24,29H,14,17-18H2,1-5H3/t21-,24+,29+/m1/s1 |
| InChIKey | NOSTVMKQCDNAPP-JICQUXPRSA-N |
| XLogP | 7.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.70 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|